C23H21F3N2 — CID 146267009
N-[2-[3-(benzhydrylideneamino)phenyl]ethyl]-2,2,2-trifluoroethanamine (PubChem CID 146267009) has the molecular formula C23H21F3N2 and a molecular weight of 382.43 g/mol. Its IUPAC name is N-[2-[3-(benzhydrylideneamino)phenyl]ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-[3-(benzhydrylideneamino)phenyl]ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 146267009 |
| Molecular Formula | C23H21F3N2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[2-[3-(benzhydrylideneamino)phenyl]ethyl]-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CNCCc1cccc(N=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C23H21F3N2/c24-23(25,26)17-27-15-14-18-8-7-13-21(16-18)28-22(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-13,16,27H,14-15,17H2 |
| InChIKey | HISFGESAITVMTN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|