C16H23F3 — CID 146270322
1-methyl-4-(3-methylheptan-3-yl)-2-(trifluoromethyl)benzene (PubChem CID 146270322) has the molecular formula C16H23F3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-methyl-4-(3-methylheptan-3-yl)-2-(trifluoromethyl)benzene.
| Compound Name | 1-methyl-4-(3-methylheptan-3-yl)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 146270322 |
| Molecular Formula | C16H23F3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-methyl-4-(3-methylheptan-3-yl)-2-(trifluoromethyl)benzene |
| SMILES | CCCCC(C)(CC)c1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H23F3/c1-5-7-10-15(4,6-2)13-9-8-12(3)14(11-13)16(17,18)19/h8-9,11H,5-7,10H2,1-4H3 |
| InChIKey | GJCGNSAYZFSTSV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |