C21H23ClN2O4 — CID 146271375
tert-butyl 6-chloro-3-[(3,5-dimethoxyphenyl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate (PubChem CID 146271375) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is tert-butyl 6-chloro-3-[(3,5-dimethoxyphenyl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-chloro-3-[(3,5-dimethoxyphenyl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 146271375 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | tert-butyl 6-chloro-3-[(3,5-dimethoxyphenyl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
| SMILES | COc1cc(Cc2cn(C(=O)OC(C)(C)C)c3nc(Cl)ccc23)cc(OC)c1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-21(2,3)28-20(25)24-12-14(17-6-7-18(22)23-19(17)24)8-13-9-15(26-4)11-16(10-13)27-5/h6-7,9-12H,8H2,1-5H3 |
| InChIKey | REHPSLBFSSJOMO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|