C24H17BrClN7O3 — CID 146276121
(Z)-N-[[5-[2-(4-bromophenoxy)-3-chlorophenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine (PubChem CID 146276121) has the molecular formula C24H17BrClN7O3 and a molecular weight of 566.80 g/mol. Its IUPAC name is (Z)-N-[[5-[2-(4-bromophenoxy)-3-chlorophenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine.
| Compound Name | (Z)-N-[[5-[2-(4-bromophenoxy)-3-chlorophenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 146276121 |
| Molecular Formula | C24H17BrClN7O3 |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | (Z)-N-[[5-[2-(4-bromophenoxy)-3-chlorophenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
| SMILES | Cn1nnnc1/C(=N\OCc1nnc(-c2cccc(Cl)c2Oc2ccc(Br)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H17BrClN7O3/c1-33-23(28-31-32-33)21(15-6-3-2-4-7-15)30-34-14-20-27-29-24(36-20)18-8-5-9-19(26)22(18)35-17-12-10-16(25)11-13-17/h2-13H,14H2,1H3/b30-21- |
| InChIKey | KCWNECKPWDRGPA-OFWBYEQRSA-N |
| XLogP | 5.44 |
| TPSA | 113.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|