C25H20ClN7O4 — CID 146276033
(Z)-N-[[5-[5-chloro-2-(3-methoxyphenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine (PubChem CID 146276033) has the molecular formula C25H20ClN7O4 and a molecular weight of 517.93 g/mol. Its IUPAC name is (Z)-N-[[5-[5-chloro-2-(3-methoxyphenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine.
| Compound Name | (Z)-N-[[5-[5-chloro-2-(3-methoxyphenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 146276033 |
| Molecular Formula | C25H20ClN7O4 |
| Molecular Weight | 517.93 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | (Z)-N-[[5-[5-chloro-2-(3-methoxyphenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
| SMILES | COc1cccc(Oc2ccc(Cl)cc2-c2nnc(CO/N=C(/c3ccccc3)c3nnnn3C)o2)c1 |
| InChI | InChI=1S/C25H20ClN7O4/c1-33-24(28-31-32-33)23(16-7-4-3-5-8-16)30-35-15-22-27-29-25(37-22)20-13-17(26)11-12-21(20)36-19-10-6-9-18(14-19)34-2/h3-14H,15H2,1-2H3/b30-23- |
| InChIKey | RHMGXPKAQVJYFL-WMMMYUQOSA-N |
| XLogP | 4.68 |
| TPSA | 122.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|