C24H19ClFN7O3 — CID 146275855
(Z)-N-[[5-[3-chloro-4-(4-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyl-2,3-dihydrotetrazol-5-yl)-1-phenylmethanimine (PubChem CID 146275855) has the molecular formula C24H19ClFN7O3 and a molecular weight of 507.91 g/mol. Its IUPAC name is (Z)-N-[[5-[3-chloro-4-(4-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyl-2,3-dihydrotetrazol-5-yl)-1-phenylmethanimine.
| Compound Name | (Z)-N-[[5-[3-chloro-4-(4-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyl-2,3-dihydrotetrazol-5-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 146275855 |
| Molecular Formula | C24H19ClFN7O3 |
| Molecular Weight | 507.91 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (Z)-N-[[5-[3-chloro-4-(4-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyl-2,3-dihydrotetrazol-5-yl)-1-phenylmethanimine |
| SMILES | CN1NNN=C1/C(=N\OCc1nnc(-c2ccc(Oc3ccc(F)cc3)c(Cl)c2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H19ClFN7O3/c1-33-23(28-31-32-33)22(15-5-3-2-4-6-15)30-34-14-21-27-29-24(36-21)16-7-12-20(19(25)13-16)35-18-10-8-17(26)9-11-18/h2-13,31-32H,14H2,1H3/b30-22- |
| InChIKey | KAACGBAAWTZHKF-SWKFRHMKSA-N |
| XLogP | 4.51 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.91 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|