C25H19F2N7O4 — CID 146276125
(Z)-N-[[5-[4-(3,5-difluorophenoxy)-2-methoxyphenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine (PubChem CID 146276125) has the molecular formula C25H19F2N7O4 and a molecular weight of 519.47 g/mol. Its IUPAC name is (Z)-N-[[5-[4-(3,5-difluorophenoxy)-2-methoxyphenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine.
| Compound Name | (Z)-N-[[5-[4-(3,5-difluorophenoxy)-2-methoxyphenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 146276125 |
| Molecular Formula | C25H19F2N7O4 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (Z)-N-[[5-[4-(3,5-difluorophenoxy)-2-methoxyphenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
| SMILES | COc1cc(Oc2cc(F)cc(F)c2)ccc1-c1nnc(CO/N=C(/c2ccccc2)c2nnnn2C)o1 |
| InChI | InChI=1S/C25H19F2N7O4/c1-34-24(29-32-33-34)23(15-6-4-3-5-7-15)31-36-14-22-28-30-25(38-22)20-9-8-18(13-21(20)35-2)37-19-11-16(26)10-17(27)12-19/h3-13H,14H2,1-2H3/b31-23- |
| InChIKey | FLWPYHIPEYAJQD-SXBRIOAWSA-N |
| XLogP | 4.31 |
| TPSA | 122.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|