C24H18FN7O3 — CID 146276022
(Z)-N-[[5-[4-(2-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine (PubChem CID 146276022) has the molecular formula C24H18FN7O3 and a molecular weight of 471.45 g/mol. Its IUPAC name is (Z)-N-[[5-[4-(2-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine.
| Compound Name | (Z)-N-[[5-[4-(2-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 146276022 |
| Molecular Formula | C24H18FN7O3 |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (Z)-N-[[5-[4-(2-fluorophenoxy)phenyl]-1,3,4-oxadiazol-2-yl]methoxy]-1-(1-methyltetrazol-5-yl)-1-phenylmethanimine |
| SMILES | Cn1nnnc1/C(=N\OCc1nnc(-c2ccc(Oc3ccccc3F)cc2)o1)c1ccccc1 |
| InChI | InChI=1S/C24H18FN7O3/c1-32-23(27-30-31-32)22(16-7-3-2-4-8-16)29-33-15-21-26-28-24(35-21)17-11-13-18(14-12-17)34-20-10-6-5-9-19(20)25/h2-14H,15H2,1H3/b29-22- |
| InChIKey | LXIYOAVQZIVQME-IADYIPOJSA-N |
| XLogP | 4.16 |
| TPSA | 113.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|