C17H30O3 — CID 146287251
5-ethyl-10-methyltetradecane-6,7,9-trione (PubChem CID 146287251) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 5-ethyl-10-methyltetradecane-6,7,9-trione.
| Compound Name | 5-ethyl-10-methyltetradecane-6,7,9-trione |
|---|---|
| PubChem CID | 146287251 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 5-ethyl-10-methyltetradecane-6,7,9-trione |
| SMILES | CCCCC(C)C(=O)CC(=O)C(=O)C(CC)CCCC |
| InChI | InChI=1S/C17H30O3/c1-5-8-10-13(4)15(18)12-16(19)17(20)14(7-3)11-9-6-2/h13-14H,5-12H2,1-4H3 |
| InChIKey | XARPTNLZPHDGPB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|