About 6-ethyl-2-methyldecane-3,5-dione
6-ethyl-2-methyldecane-3,5-dione (PubChem CID 158922502) has the molecular formula C26H48O4
and a molecular weight of 424.67 g/mol. Its IUPAC name is 6-ethyl-2-methyldecane-3,5-dione.
Molecular Properties
| Compound Name | 6-ethyl-2-methyldecane-3,5-dione |
| PubChem CID | 158922502 |
| Molecular Formula | C26H48O4 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.36 |
| IUPAC Name | 6-ethyl-2-methyldecane-3,5-dione |
| SMILES | CCCCC(CC)C(=O)CC(=O)C(C)C.CCCCC(CC)C(=O)CC(=O)C(C)C |
| InChI | InChI=1S/2C13H24O2/c2*1-5-7-8-11(6-2)13(15)9-12(14)10(3)4/h2*10-11H,5-9H2,1-4H3 |
| InChIKey | JHZZBLOOEAFARO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2-methyldecane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-methyldecane-3,5-dione?
The IUPAC name of 6-ethyl-2-methyldecane-3,5-dione (CID 158922502) is 6-ethyl-2-methyldecane-3,5-dione.
What is the SMILES notation for 6-ethyl-2-methyldecane-3,5-dione?
The canonical SMILES for 6-ethyl-2-methyldecane-3,5-dione is CCCCC(CC)C(=O)CC(=O)C(C)C.CCCCC(CC)C(=O)CC(=O)C(C)C.
What is the InChIKey of 6-ethyl-2-methyldecane-3,5-dione?
The InChIKey is JHZZBLOOEAFARO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H24O2/c2*1-5-7-8-11(6-2)13(15)9-12(14)10(3)4/h2*10-11H,5-9H2,1-4H3.
What are the key properties of 6-ethyl-2-methyldecane-3,5-dione?
6-ethyl-2-methyldecane-3,5-dione has a molecular weight of 424.67 g/mol, XLogP of 6.77, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-methyldecane-3,5-dione is sourced from PubChem (CID 158922502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).