C21H40O2 — CID 19870279
5,11-diethyl-8,8-dimethylpentadecane-6,10-dione (PubChem CID 19870279) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is 5,11-diethyl-8,8-dimethylpentadecane-6,10-dione.
| Compound Name | 5,11-diethyl-8,8-dimethylpentadecane-6,10-dione |
|---|---|
| PubChem CID | 19870279 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | 5,11-diethyl-8,8-dimethylpentadecane-6,10-dione |
| SMILES | CCCCC(CC)C(=O)CC(C)(C)CC(=O)C(CC)CCCC |
| InChI | InChI=1S/C21H40O2/c1-7-11-13-17(9-3)19(22)15-21(5,6)16-20(23)18(10-4)14-12-8-2/h17-18H,7-16H2,1-6H3 |
| InChIKey | PBRRXRSLWSSNAW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |