C25H30N2O3 — CID 146290898
trans-tert-butyl (1R,2R)-4-methoxy-4-[2-(4-methylpyridazin-3-yl)ethynyl]-2-phenylcyclohexane-1-carboxylate (PubChem CID 146290898) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is trans-tert-butyl (1R,2R)-4-methoxy-4-[2-(4-methylpyridazin-3-yl)ethynyl]-2-phenylcyclohexane-1-carboxylate.
| Compound Name | trans-tert-butyl (1R,2R)-4-methoxy-4-[2-(4-methylpyridazin-3-yl)ethynyl]-2-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 146290898 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | trans-tert-butyl (1R,2R)-4-methoxy-4-[2-(4-methylpyridazin-3-yl)ethynyl]-2-phenylcyclohexane-1-carboxylate |
| SMILES | COC1(C#Cc2nnccc2C)CC[C@@H](C(=O)OC(C)(C)C)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C25H30N2O3/c1-18-13-16-26-27-22(18)12-15-25(29-5)14-11-20(23(28)30-24(2,3)4)21(17-25)19-9-7-6-8-10-19/h6-10,13,16,20-21H,11,14,17H2,1-5H3/t20-,21+,25?/m1/s1 |
| InChIKey | ZCHQRKKIRUWGCB-GJAAFAAWSA-N |
| XLogP | 4.45 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|