C24H24O6S — CID 14630132
methyl (3aR,6S,7S,7aR)-7-benzoyloxy-2,2-dimethyl-6-phenylsulfanyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 14630132) has the molecular formula C24H24O6S and a molecular weight of 440.52 g/mol. Its IUPAC name is methyl (3aR,6S,7S,7aR)-7-benzoyloxy-2,2-dimethyl-6-phenylsulfanyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,6S,7S,7aR)-7-benzoyloxy-2,2-dimethyl-6-phenylsulfanyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 14630132 |
| Molecular Formula | C24H24O6S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | methyl (3aR,6S,7S,7aR)-7-benzoyloxy-2,2-dimethyl-6-phenylsulfanyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2OC(C)(C)O[C@H]2[C@H](OC(=O)c2ccccc2)[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C24H24O6S/c1-24(2)29-18-14-17(23(26)27-3)21(31-16-12-8-5-9-13-16)20(19(18)30-24)28-22(25)15-10-6-4-7-11-15/h4-14,18-21H,1-3H3/t18-,19-,20+,21+/m1/s1 |
| InChIKey | GXNUBXAICXTEAH-CGXNFDGLSA-N |
| XLogP | 4.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |