C29H43N3O4 — CID 146331769
3-methoxypropyl 1-[[2-(4-tert-butylcyclohexyl)oxyquinazolin-6-yl]methyl]piperidine-4-carboxylate (PubChem CID 146331769) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is 3-methoxypropyl 1-[[2-(4-tert-butylcyclohexyl)oxyquinazolin-6-yl]methyl]piperidine-4-carboxylate.
| Compound Name | 3-methoxypropyl 1-[[2-(4-tert-butylcyclohexyl)oxyquinazolin-6-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 146331769 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 3-methoxypropyl 1-[[2-(4-tert-butylcyclohexyl)oxyquinazolin-6-yl]methyl]piperidine-4-carboxylate |
| SMILES | COCCCOC(=O)C1CCN(Cc2ccc3nc(OC4CCC(C(C)(C)C)CC4)ncc3c2)CC1 |
| InChI | InChI=1S/C29H43N3O4/c1-29(2,3)24-7-9-25(10-8-24)36-28-30-19-23-18-21(6-11-26(23)31-28)20-32-14-12-22(13-15-32)27(33)35-17-5-16-34-4/h6,11,18-19,22,24-25H,5,7-10,12-17,20H2,1-4H3 |
| InChIKey | GDHNSWLSCZVBCF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|