C41H56F2N2O3 — CID 146361002
[(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 10-[[(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]oxy]undec-10-enoate (PubChem CID 146361002) has the molecular formula C41H56F2N2O3 and a molecular weight of 662.91 g/mol. Its IUPAC name is [(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 10-[[(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]oxy]undec-10-enoate.
| Compound Name | [(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 10-[[(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]oxy]undec-10-enoate |
|---|---|
| PubChem CID | 146361002 |
| Molecular Formula | C41H56F2N2O3 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.43 |
| IUPAC Name | [(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 10-[[(1R,9S,15S)-15-amino-6-fluoro-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]oxy]undec-10-enoate |
| SMILES | C=C(CCCCCCCCC(=O)Oc1cc(F)c2c(c1)[C@H]1CCCCC[C@@H](C2)[C@@H]1N)Oc1cc(F)c2c(c1)[C@H]1CCCCC[C@@H](C2)[C@@H]1N |
| InChI | InChI=1S/C41H56F2N2O3/c1-26(47-29-22-33-31-17-11-6-9-15-27(40(31)44)20-35(33)37(42)24-29)14-8-4-2-3-5-13-19-39(46)48-30-23-34-32-18-12-7-10-16-28(41(32)45)21-36(34)38(43)25-30/h22-25,27-28,31-32,40-41H,1-21,44-45H2/t27-,28-,31+,32+,40-,41-/m0/s1 |
| InChIKey | XOQJOWATHOLJHM-HJQAIXDVSA-N |
| XLogP | 9.68 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|