C14H23N5O2 — CID 146403548
7-[hexyl(methyl)amino]-1,3-dimethylpurine-2,6-dione (PubChem CID 146403548) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 7-[hexyl(methyl)amino]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[hexyl(methyl)amino]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 146403548 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 7-[hexyl(methyl)amino]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCCCCN(C)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H23N5O2/c1-5-6-7-8-9-16(2)19-10-15-12-11(19)13(20)18(4)14(21)17(12)3/h10H,5-9H2,1-4H3 |
| InChIKey | UJTMETIADPODSZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|