C15H25N5O2 — CID 146403539
8-[hexyl(methyl)amino]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 146403539) has the molecular formula C15H25N5O2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 8-[hexyl(methyl)amino]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[hexyl(methyl)amino]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 146403539 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 8-[hexyl(methyl)amino]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | CCCCCCN(C)c1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C15H25N5O2/c1-6-7-8-9-10-17(2)14-16-12-11(18(14)3)13(21)20(5)15(22)19(12)4/h6-10H2,1-5H3 |
| InChIKey | LHXUVEQVVPJNPW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|