C20H33N5O3 — CID 153454333
N,1,3,7-tetramethyl-N-(2-methylnonan-4-yl)-2,6-dioxopurine-8-carboxamide (PubChem CID 153454333) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is N,1,3,7-tetramethyl-N-(2-methylnonan-4-yl)-2,6-dioxopurine-8-carboxamide.
| Compound Name | N,1,3,7-tetramethyl-N-(2-methylnonan-4-yl)-2,6-dioxopurine-8-carboxamide |
|---|---|
| PubChem CID | 153454333 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N,1,3,7-tetramethyl-N-(2-methylnonan-4-yl)-2,6-dioxopurine-8-carboxamide |
| SMILES | CCCCCC(CC(C)C)N(C)C(=O)c1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C20H33N5O3/c1-8-9-10-11-14(12-13(2)3)22(4)19(27)17-21-16-15(23(17)5)18(26)25(7)20(28)24(16)6/h13-14H,8-12H2,1-7H3 |
| InChIKey | DHVOCERNIKIJON-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|