C27H43NO6 — CID 146419073
methyl 2-[[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-1-hydroxyethyl]-methylamino]acetate (PubChem CID 146419073) has the molecular formula C27H43NO6 and a molecular weight of 477.64 g/mol. Its IUPAC name is methyl 2-[[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-1-hydroxyethyl]-methylamino]acetate.
| Compound Name | methyl 2-[[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-1-hydroxyethyl]-methylamino]acetate |
|---|---|
| PubChem CID | 146419073 |
| Molecular Formula | C27H43NO6 |
| Molecular Weight | 477.64 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | methyl 2-[[2-[[(1R,2R,3aS,9aS)-2-hydroxy-1-[(3S)-3-hydroxyoctyl]-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[g]naphthalen-5-yl]oxy]-1-hydroxyethyl]-methylamino]acetate |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@H]2Cc3cccc(OCC(O)N(C)CC(=O)OC)c3C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H43NO6/c1-4-5-6-9-20(29)11-12-21-22-13-18-8-7-10-25(23(18)14-19(22)15-24(21)30)34-17-26(31)28(2)16-27(32)33-3/h7-8,10,19-22,24,26,29-31H,4-6,9,11-17H2,1-3H3/t19-,20-,21+,22-,24+,26?/m0/s1 |
| InChIKey | YEDZLDIKLPQGRN-RXYUJSHFSA-N |
| XLogP | 2.92 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|