C9H15NS4 — CID 146424227
5,6,12,13-tetrathiatricyclo[9.2.0.04,7]tridecan-2-amine (PubChem CID 146424227) has the molecular formula C9H15NS4 and a molecular weight of 265.49 g/mol. Its IUPAC name is 5,6,12,13-tetrathiatricyclo[9.2.0.04,7]tridecan-2-amine.
| Compound Name | 5,6,12,13-tetrathiatricyclo[9.2.0.04,7]tridecan-2-amine |
|---|---|
| PubChem CID | 146424227 |
| Molecular Formula | C9H15NS4 |
| Molecular Weight | 265.49 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 5,6,12,13-tetrathiatricyclo[9.2.0.04,7]tridecan-2-amine |
| SMILES | NC1CC2SSC2CCCC2SSC12 |
| InChI | InChI=1S/C9H15NS4/c10-5-4-8-6(11-13-8)2-1-3-7-9(5)14-12-7/h5-9H,1-4,10H2 |
| InChIKey | MJHNWIWZQGKSOI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|