C14H17F — CID 146429705
8-fluoro-1,1,2,2-tetramethylnaphthalene (PubChem CID 146429705) has the molecular formula C14H17F and a molecular weight of 204.29 g/mol. Its IUPAC name is 8-fluoro-1,1,2,2-tetramethylnaphthalene.
| Compound Name | 8-fluoro-1,1,2,2-tetramethylnaphthalene |
|---|---|
| PubChem CID | 146429705 |
| Molecular Formula | C14H17F |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 8-fluoro-1,1,2,2-tetramethylnaphthalene |
| SMILES | CC1(C)C=Cc2cccc(F)c2C1(C)C |
| InChI | InChI=1S/C14H17F/c1-13(2)9-8-10-6-5-7-11(15)12(10)14(13,3)4/h5-9H,1-4H3 |
| InChIKey | CBFGLJOGSGUCNJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |