C14H19F — CID 156894039
ethane;7-fluoro-1,1,5-trimethylindene (PubChem CID 156894039) has the molecular formula C14H19F and a molecular weight of 206.30 g/mol. Its IUPAC name is ethane;7-fluoro-1,1,5-trimethylindene.
| Compound Name | ethane;7-fluoro-1,1,5-trimethylindene |
|---|---|
| PubChem CID | 156894039 |
| Molecular Formula | C14H19F |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | ethane;7-fluoro-1,1,5-trimethylindene |
| SMILES | CC.Cc1cc(F)c2c(c1)C=CC2(C)C |
| InChI | InChI=1S/C12H13F.C2H6/c1-8-6-9-4-5-12(2,3)11(9)10(13)7-8;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | DTKFERDZOUOFNP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |