C22H20F6 — CID 138735477
3,3,4-trifluoro-6-methyl-2-[2-(3,3,4-trifluoro-6-methyl-1,2-dihydroinden-2-yl)ethyl]-1,2-dihydroindene (PubChem CID 138735477) has the molecular formula C22H20F6 and a molecular weight of 398.39 g/mol. Its IUPAC name is 3,3,4-trifluoro-6-methyl-2-[2-(3,3,4-trifluoro-6-methyl-1,2-dihydroinden-2-yl)ethyl]-1,2-dihydroindene.
| Compound Name | 3,3,4-trifluoro-6-methyl-2-[2-(3,3,4-trifluoro-6-methyl-1,2-dihydroinden-2-yl)ethyl]-1,2-dihydroindene |
|---|---|
| PubChem CID | 138735477 |
| Molecular Formula | C22H20F6 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3,3,4-trifluoro-6-methyl-2-[2-(3,3,4-trifluoro-6-methyl-1,2-dihydroinden-2-yl)ethyl]-1,2-dihydroindene |
| SMILES | Cc1cc(F)c2c(c1)CC(CCC1Cc3cc(C)cc(F)c3C1(F)F)C2(F)F |
| InChI | InChI=1S/C22H20F6/c1-11-5-13-9-15(21(25,26)19(13)17(23)7-11)3-4-16-10-14-6-12(2)8-18(24)20(14)22(16,27)28/h5-8,15-16H,3-4,9-10H2,1-2H3 |
| InChIKey | CEBMLKANAFYYRN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |