C22H19F7 — CID 138718579
3,3,4,5-tetrafluoro-6-methyl-2-[2-(1,1,7-trifluoro-2-methyl-2,3-dihydroinden-5-yl)ethyl]-1,2-dihydroindene (PubChem CID 138718579) has the molecular formula C22H19F7 and a molecular weight of 416.38 g/mol. Its IUPAC name is 3,3,4,5-tetrafluoro-6-methyl-2-[2-(1,1,7-trifluoro-2-methyl-2,3-dihydroinden-5-yl)ethyl]-1,2-dihydroindene.
| Compound Name | 3,3,4,5-tetrafluoro-6-methyl-2-[2-(1,1,7-trifluoro-2-methyl-2,3-dihydroinden-5-yl)ethyl]-1,2-dihydroindene |
|---|---|
| PubChem CID | 138718579 |
| Molecular Formula | C22H19F7 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3,3,4,5-tetrafluoro-6-methyl-2-[2-(1,1,7-trifluoro-2-methyl-2,3-dihydroinden-5-yl)ethyl]-1,2-dihydroindene |
| SMILES | Cc1cc2c(c(F)c1F)C(F)(F)C(CCc1cc(F)c3c(c1)CC(C)C3(F)F)C2 |
| InChI | InChI=1S/C22H19F7/c1-10-5-13-9-15(22(28,29)18(13)20(25)19(10)24)4-3-12-7-14-6-11(2)21(26,27)17(14)16(23)8-12/h5,7-8,11,15H,3-4,6,9H2,1-2H3 |
| InChIKey | DHCUTDMYSSZHDJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |