C19H14F6O — CID 87664176
2-(2,3-difluoro-4-methylphenyl)-3,3,4,5-tetrafluoro-6-prop-2-enoxy-1,2-dihydroindene (PubChem CID 87664176) has the molecular formula C19H14F6O and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-(2,3-difluoro-4-methylphenyl)-3,3,4,5-tetrafluoro-6-prop-2-enoxy-1,2-dihydroindene.
| Compound Name | 2-(2,3-difluoro-4-methylphenyl)-3,3,4,5-tetrafluoro-6-prop-2-enoxy-1,2-dihydroindene |
|---|---|
| PubChem CID | 87664176 |
| Molecular Formula | C19H14F6O |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-(2,3-difluoro-4-methylphenyl)-3,3,4,5-tetrafluoro-6-prop-2-enoxy-1,2-dihydroindene |
| SMILES | C=CCOc1cc2c(c(F)c1F)C(F)(F)C(c1ccc(C)c(F)c1F)C2 |
| InChI | InChI=1S/C19H14F6O/c1-3-6-26-13-8-10-7-12(11-5-4-9(2)15(20)16(11)21)19(24,25)14(10)18(23)17(13)22/h3-5,8,12H,1,6-7H2,2H3 |
| InChIKey | WIQRDZPKPPVURQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|