C22H23F3O3 — CID 58141301
5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-[(2-fluoro-4-methylphenoxy)methyl]oxane (PubChem CID 58141301) has the molecular formula C22H23F3O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-[(2-fluoro-4-methylphenoxy)methyl]oxane.
| Compound Name | 5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-[(2-fluoro-4-methylphenoxy)methyl]oxane |
|---|---|
| PubChem CID | 58141301 |
| Molecular Formula | C22H23F3O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-[(2-fluoro-4-methylphenoxy)methyl]oxane |
| SMILES | C=CCOc1ccc(C2CCC(COc3ccc(C)cc3F)OC2)c(F)c1F |
| InChI | InChI=1S/C22H23F3O3/c1-3-10-26-20-9-7-17(21(24)22(20)25)15-5-6-16(27-12-15)13-28-19-8-4-14(2)11-18(19)23/h3-4,7-9,11,15-16H,1,5-6,10,12-13H2,2H3 |
| InChIKey | YOFIHCNEUINEOE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|