C18H19NO4 — CID 14643508
3,3-dimethyl-2-(4-methylphenoxy)-2-(4-nitrophenyl)oxetane (PubChem CID 14643508) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3,3-dimethyl-2-(4-methylphenoxy)-2-(4-nitrophenyl)oxetane.
| Compound Name | 3,3-dimethyl-2-(4-methylphenoxy)-2-(4-nitrophenyl)oxetane |
|---|---|
| PubChem CID | 14643508 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3,3-dimethyl-2-(4-methylphenoxy)-2-(4-nitrophenyl)oxetane |
| SMILES | Cc1ccc(OC2(c3ccc([N+](=O)[O-])cc3)OCC2(C)C)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-13-4-10-16(11-5-13)23-18(17(2,3)12-22-18)14-6-8-15(9-7-14)19(20)21/h4-11H,12H2,1-3H3 |
| InChIKey | YEVNLRSJOYOCGV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|