C14H14Cl2O2 — CID 146458835
3-[3-(3,4-dichlorophenyl)-2-oxopropyl]cyclopentan-1-one (PubChem CID 146458835) has the molecular formula C14H14Cl2O2 and a molecular weight of 285.17 g/mol. Its IUPAC name is 3-[3-(3,4-dichlorophenyl)-2-oxopropyl]cyclopentan-1-one.
| Compound Name | 3-[3-(3,4-dichlorophenyl)-2-oxopropyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 146458835 |
| Molecular Formula | C14H14Cl2O2 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-[3-(3,4-dichlorophenyl)-2-oxopropyl]cyclopentan-1-one |
| SMILES | O=C1CCC(CC(=O)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H14Cl2O2/c15-13-4-2-10(8-14(13)16)7-12(18)6-9-1-3-11(17)5-9/h2,4,8-9H,1,3,5-7H2 |
| InChIKey | DWWLBTYSGYZJQI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |