C18H18FN3O4S — CID 146475007
5-[[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]carbamoyl]-1H-pyrrole-3-sulfonyl fluoride (PubChem CID 146475007) has the molecular formula C18H18FN3O4S and a molecular weight of 391.42 g/mol. Its IUPAC name is 5-[[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]carbamoyl]-1H-pyrrole-3-sulfonyl fluoride.
| Compound Name | 5-[[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]carbamoyl]-1H-pyrrole-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 146475007 |
| Molecular Formula | C18H18FN3O4S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-[[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]carbamoyl]-1H-pyrrole-3-sulfonyl fluoride |
| SMILES | CC(C)C(NC(=O)c1cc(S(=O)(=O)F)c[nH]1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C18H18FN3O4S/c1-10(2)15(13-6-5-11-4-3-7-20-16(11)17(13)23)22-18(24)14-8-12(9-21-14)27(19,25)26/h3-10,15,21,23H,1-2H3,(H,22,24) |
| InChIKey | MWXZBJHZFUSZHI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|