C17H17N3O4 — CID 146475027
N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-oxo-3H-1,3-oxazole-4-carboxamide (PubChem CID 146475027) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-oxo-3H-1,3-oxazole-4-carboxamide.
| Compound Name | N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-oxo-3H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 146475027 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-oxo-3H-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)C(NC(=O)c1coc(=O)[nH]1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C17H17N3O4/c1-9(2)13(20-16(22)12-8-24-17(23)19-12)11-6-5-10-4-3-7-18-14(10)15(11)21/h3-9,13,21H,1-2H3,(H,19,23)(H,20,22) |
| InChIKey | ZRZKSJJCOQTOJM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|