C17H20N4O2 — CID 146475061
(E)-3-amino-N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-methanimidoylprop-2-enamide (PubChem CID 146475061) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (E)-3-amino-N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-methanimidoylprop-2-enamide.
| Compound Name | (E)-3-amino-N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-methanimidoylprop-2-enamide |
|---|---|
| PubChem CID | 146475061 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (E)-3-amino-N-[1-(8-hydroxyquinolin-7-yl)-2-methylpropyl]-2-methanimidoylprop-2-enamide |
| SMILES | [H]/N=C/C(=C\N)C(=O)NC(c1ccc2cccnc2c1O)C(C)C |
| InChI | InChI=1S/C17H20N4O2/c1-10(2)14(21-17(23)12(8-18)9-19)13-6-5-11-4-3-7-20-15(11)16(13)22/h3-10,14,18,22H,19H2,1-2H3,(H,21,23)/b12-9+,18-8+ |
| InChIKey | XDAGGBYVZIDFGB-VYPTZEEMSA-N |
| XLogP | 2.25 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|