C28H28N2 — CID 146492297
N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-methyl-7-(1-phenylethenyl)quinolin-8-yl]propan-2-imine (PubChem CID 146492297) has the molecular formula C28H28N2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-methyl-7-(1-phenylethenyl)quinolin-8-yl]propan-2-imine.
| Compound Name | N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-methyl-7-(1-phenylethenyl)quinolin-8-yl]propan-2-imine |
|---|---|
| PubChem CID | 146492297 |
| Molecular Formula | C28H28N2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | N-[4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2-methyl-7-(1-phenylethenyl)quinolin-8-yl]propan-2-imine |
| SMILES | C=C/C=C\C=C(/C)c1cc(C)nc2c(N=C(C)C)c(C(=C)c3ccccc3)ccc12 |
| InChI | InChI=1S/C28H28N2/c1-7-8-10-13-20(4)26-18-21(5)30-28-25(26)17-16-24(27(28)29-19(2)3)22(6)23-14-11-9-12-15-23/h7-18H,1,6H2,2-5H3/b10-8-,20-13+ |
| InChIKey | LNTXPXBEEUZSQM-VKIANQOQSA-N |
| XLogP | 7.86 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|