C22H20N2 — CID 167232170
4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5-diphenyl-1H-imidazole (PubChem CID 167232170) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5-diphenyl-1H-imidazole.
| Compound Name | 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 167232170 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-2,5-diphenyl-1H-imidazole |
| SMILES | C=C/C=C\C=C(/C)c1nc(-c2ccccc2)[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C22H20N2/c1-3-4-7-12-17(2)20-21(18-13-8-5-9-14-18)24-22(23-20)19-15-10-6-11-16-19/h3-16H,1H2,2H3,(H,23,24)/b7-4-,17-12+ |
| InChIKey | UOPSZAFKFGXNTA-LUJAEEAZSA-N |
| XLogP | 5.89 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|