C10H8ClN3OS — CID 146506910
N-(4-chlorophenyl)-5-oxo-1H-pyrazole-2-carbothioamide (PubChem CID 146506910) has the molecular formula C10H8ClN3OS and a molecular weight of 253.71 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-oxo-1H-pyrazole-2-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-5-oxo-1H-pyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 146506910 |
| Molecular Formula | C10H8ClN3OS |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | N-(4-chlorophenyl)-5-oxo-1H-pyrazole-2-carbothioamide |
| SMILES | O=c1ccn(C(=S)Nc2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C10H8ClN3OS/c11-7-1-3-8(4-2-7)12-10(16)14-6-5-9(15)13-14/h1-6H,(H,12,16)(H,13,15) |
| InChIKey | ZDIWOKVJEQVQJV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|