C7H9IO — CID 146510629
(2R,3S,5R)-5-ethynyl-3-iodo-2-methyloxolane (PubChem CID 146510629) has the molecular formula C7H9IO and a molecular weight of 236.05 g/mol. Its IUPAC name is (2R,3S,5R)-5-ethynyl-3-iodo-2-methyloxolane.
| Compound Name | (2R,3S,5R)-5-ethynyl-3-iodo-2-methyloxolane |
|---|---|
| PubChem CID | 146510629 |
| Molecular Formula | C7H9IO |
| Molecular Weight | 236.05 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | (2R,3S,5R)-5-ethynyl-3-iodo-2-methyloxolane |
| SMILES | C#C[C@H]1C[C@H](I)[C@@H](C)O1 |
| InChI | InChI=1S/C7H9IO/c1-3-6-4-7(8)5(2)9-6/h1,5-7H,4H2,2H3/t5-,6+,7+/m1/s1 |
| InChIKey | QPINEYUZSJFQBR-VQVTYTSYSA-N |
| XLogP | 1.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.05 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|