About N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine
N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine (PubChem CID 146513568) has the molecular formula C13H16BrN3
and a molecular weight of 294.20 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine.
Molecular Properties
| Compound Name | N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine |
| PubChem CID | 146513568 |
| Molecular Formula | C13H16BrN3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine |
| SMILES | CN1CC2CC23CC(Nc2ccc(Br)cn2)C13 |
| InChI | InChI=1S/C13H16BrN3/c1-17-7-8-4-13(8)5-10(12(13)17)16-11-3-2-9(14)6-15-11/h2-3,6,8,10,12H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | YSFXTEHKWLBQST-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine?
The IUPAC name of N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine (CID 146513568) is N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine.
What is the SMILES notation for N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine?
The canonical SMILES for N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine is CN1CC2CC23CC(Nc2ccc(Br)cn2)C13.
What is the InChIKey of N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine?
The InChIKey is YSFXTEHKWLBQST-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN3/c1-17-7-8-4-13(8)5-10(12(13)17)16-11-3-2-9(14)6-15-11/h2-3,6,8,10,12H,4-5,7H2,1H3,(H,15,16).
What are the key properties of N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine?
N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine has a molecular weight of 294.20 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-pyridinyl)-5-methyl-5-azatricyclo[4.2.0.01,3]octan-7-amine is sourced from PubChem (CID 146513568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).