C19H28O2 — CID 146514562
(1R,5S,9S,11S)-7-(hydroxymethyl)-3,10,10,11-tetramethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one (PubChem CID 146514562) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1R,5S,9S,11S)-7-(hydroxymethyl)-3,10,10,11-tetramethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one.
| Compound Name | (1R,5S,9S,11S)-7-(hydroxymethyl)-3,10,10,11-tetramethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one |
|---|---|
| PubChem CID | 146514562 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1R,5S,9S,11S)-7-(hydroxymethyl)-3,10,10,11-tetramethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one |
| SMILES | CC1=C[C@@]23CC[C@H](C)C(C)(C)[C@H](C=C(CO)C[C@@H]2C1)C3=O |
| InChI | InChI=1S/C19H28O2/c1-12-7-15-8-14(11-20)9-16-17(21)19(15,10-12)6-5-13(2)18(16,3)4/h9-10,13,15-16,20H,5-8,11H2,1-4H3/t13-,15-,16+,19-/m0/s1 |
| InChIKey | XNBHPSKNKOXVGM-AMVTXUCVSA-N |
| XLogP | 3.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|