C12H21NO — CID 146514636
2-[(3Z)-2,4,6-trimethylhepta-3,5-dienyl]iminoethanol (PubChem CID 146514636) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-[(3Z)-2,4,6-trimethylhepta-3,5-dienyl]iminoethanol.
| Compound Name | 2-[(3Z)-2,4,6-trimethylhepta-3,5-dienyl]iminoethanol |
|---|---|
| PubChem CID | 146514636 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-[(3Z)-2,4,6-trimethylhepta-3,5-dienyl]iminoethanol |
| SMILES | CC(C)=C/C(C)=C\C(C)C/N=C/CO |
| InChI | InChI=1S/C12H21NO/c1-10(2)7-11(3)8-12(4)9-13-5-6-14/h5,7-8,12,14H,6,9H2,1-4H3/b11-8-,13-5+ |
| InChIKey | VXXQWFIMIKZFFL-RDDASKGTSA-N |
| XLogP | 2.60 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|