C8H13NO2 — CID 142099505
(1Z)-2-(2-hydroxyethylideneamino)-4-methylpenta-1,3-dien-1-ol (PubChem CID 142099505) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (1Z)-2-(2-hydroxyethylideneamino)-4-methylpenta-1,3-dien-1-ol.
| Compound Name | (1Z)-2-(2-hydroxyethylideneamino)-4-methylpenta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 142099505 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (1Z)-2-(2-hydroxyethylideneamino)-4-methylpenta-1,3-dien-1-ol |
| SMILES | CC(C)=CC(=C/O)/N=C/CO |
| InChI | InChI=1S/C8H13NO2/c1-7(2)5-8(6-11)9-3-4-10/h3,5-6,10-11H,4H2,1-2H3/b8-6-,9-3+ |
| InChIKey | YCONWEIBVAUDBO-FTYJLKAESA-N |
| XLogP | 1.42 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|