C19H23F2NO2 — CID 146516099
3-(3,5-difluoro-4-pentoxyphenyl)-2-propan-2-yloxypyridine (PubChem CID 146516099) has the molecular formula C19H23F2NO2 and a molecular weight of 335.39 g/mol. Its IUPAC name is 3-(3,5-difluoro-4-pentoxyphenyl)-2-propan-2-yloxypyridine.
| Compound Name | 3-(3,5-difluoro-4-pentoxyphenyl)-2-propan-2-yloxypyridine |
|---|---|
| PubChem CID | 146516099 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-(3,5-difluoro-4-pentoxyphenyl)-2-propan-2-yloxypyridine |
| SMILES | CCCCCOc1c(F)cc(-c2cccnc2OC(C)C)cc1F |
| InChI | InChI=1S/C19H23F2NO2/c1-4-5-6-10-23-18-16(20)11-14(12-17(18)21)15-8-7-9-22-19(15)24-13(2)3/h7-9,11-13H,4-6,10H2,1-3H3 |
| InChIKey | JVDDBZHLENRYJO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|