C14H16F2N2O2S — CID 146532221
(1S,2R,6S,7R)-10-(2,4-difluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 146532221) has the molecular formula C14H16F2N2O2S and a molecular weight of 314.36 g/mol. Its IUPAC name is (1S,2R,6S,7R)-10-(2,4-difluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2R,6S,7R)-10-(2,4-difluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 146532221 |
| Molecular Formula | C14H16F2N2O2S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | (1S,2R,6S,7R)-10-(2,4-difluorophenyl)sulfonyl-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1[C@@H]2CC[C@H]1[C@H]1CNC[C@H]12 |
| InChI | InChI=1S/C14H16F2N2O2S/c15-8-1-4-14(11(16)5-8)21(19,20)18-12-2-3-13(18)10-7-17-6-9(10)12/h1,4-5,9-10,12-13,17H,2-3,6-7H2/t9-,10+,12-,13+ |
| InChIKey | AKLLLRCUMWVMDY-NIFPGPBJSA-N |
| XLogP | 1.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |