C33H24N2O10 — CID 146532707
N-[2-hydroxy-5-[2-[4-hydroxy-3-[(1-hydroxy-3-oxo-1H-2-benzofuran-5-carbonyl)amino]phenyl]propan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 146532707) has the molecular formula C33H24N2O10 and a molecular weight of 608.56 g/mol. Its IUPAC name is N-[2-hydroxy-5-[2-[4-hydroxy-3-[(1-hydroxy-3-oxo-1H-2-benzofuran-5-carbonyl)amino]phenyl]propan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[2-hydroxy-5-[2-[4-hydroxy-3-[(1-hydroxy-3-oxo-1H-2-benzofuran-5-carbonyl)amino]phenyl]propan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 146532707 |
| Molecular Formula | C33H24N2O10 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | N-[2-hydroxy-5-[2-[4-hydroxy-3-[(1-hydroxy-3-oxo-1H-2-benzofuran-5-carbonyl)amino]phenyl]propan-2-yl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | CC(C)(c1ccc(O)c(NC(=O)c2ccc3c(c2)C(=O)OC3=O)c1)c1ccc(O)c(NC(=O)c2ccc3c(c2)C(=O)OC3O)c1 |
| InChI | InChI=1S/C33H24N2O10/c1-33(2,17-5-9-25(36)23(13-17)34-27(38)15-3-7-19-21(11-15)31(42)44-29(19)40)18-6-10-26(37)24(14-18)35-28(39)16-4-8-20-22(12-16)32(43)45-30(20)41/h3-14,29,36-37,40H,1-2H3,(H,34,38)(H,35,39) |
| InChIKey | SHQPHESSHHNEJF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 188.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|