C30H16N2O12S — CID 59812368
N-[5-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-hydroxyphenyl]sulfonyl-2-hydroxyphenyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 59812368) has the molecular formula C30H16N2O12S and a molecular weight of 628.53 g/mol. Its IUPAC name is N-[5-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-hydroxyphenyl]sulfonyl-2-hydroxyphenyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[5-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-hydroxyphenyl]sulfonyl-2-hydroxyphenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 59812368 |
| Molecular Formula | C30H16N2O12S |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | N-[5-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-hydroxyphenyl]sulfonyl-2-hydroxyphenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)c2ccc(O)c(NC(=O)c3ccc4c(c3)C(=O)OC4=O)c2)ccc1O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C30H16N2O12S/c33-23-7-3-15(11-21(23)31-25(35)13-1-5-17-19(9-13)29(39)43-27(17)37)45(41,42)16-4-8-24(34)22(12-16)32-26(36)14-2-6-18-20(10-14)30(40)44-28(18)38/h1-12,33-34H,(H,31,35)(H,32,36) |
| InChIKey | NQZRCIDIBNDQCG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 219.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|