C9H16INO4 — CID 146532841
2-[2-(2-amino-1-iodoethoxy)ethoxy]ethyl prop-2-enoate (PubChem CID 146532841) has the molecular formula C9H16INO4 and a molecular weight of 329.13 g/mol. Its IUPAC name is 2-[2-(2-amino-1-iodoethoxy)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(2-amino-1-iodoethoxy)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 146532841 |
| Molecular Formula | C9H16INO4 |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 2-[2-(2-amino-1-iodoethoxy)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOC(I)CN |
| InChI | InChI=1S/C9H16INO4/c1-2-9(12)15-6-4-13-3-5-14-8(10)7-11/h2,8H,1,3-7,11H2 |
| InChIKey | ZVQRDQMTUWGXTN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|