C10H5F15N2O — CID 146542041
1-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]-2,2,3,3,5,5,6,6-octafluoro-4-(trifluoromethyl)piperazine (PubChem CID 146542041) has the molecular formula C10H5F15N2O and a molecular weight of 454.13 g/mol. Its IUPAC name is 1-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]-2,2,3,3,5,5,6,6-octafluoro-4-(trifluoromethyl)piperazine.
| Compound Name | 1-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]-2,2,3,3,5,5,6,6-octafluoro-4-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 146542041 |
| Molecular Formula | C10H5F15N2O |
| Molecular Weight | 454.13 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 1-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]-2,2,3,3,5,5,6,6-octafluoro-4-(trifluoromethyl)piperazine |
| SMILES | CCO/C(=C(/F)N1C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15N2O/c1-2-28-3(5(12,13)14)4(11)26-6(15,16)8(19,20)27(10(23,24)25)9(21,22)7(26,17)18/h2H2,1H3/b4-3- |
| InChIKey | ZYPVPTUEDGVSBG-ARJAWSKDSA-N |
| XLogP | 5.23 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.13 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|