C21H44N2 — CID 146554020
1,5-ditert-butyl-2,2,4,4,6,6,8-heptamethyl-1,5-diazocane (PubChem CID 146554020) has the molecular formula C21H44N2 and a molecular weight of 324.60 g/mol. Its IUPAC name is 1,5-ditert-butyl-2,2,4,4,6,6,8-heptamethyl-1,5-diazocane.
| Compound Name | 1,5-ditert-butyl-2,2,4,4,6,6,8-heptamethyl-1,5-diazocane |
|---|---|
| PubChem CID | 146554020 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | 1,5-ditert-butyl-2,2,4,4,6,6,8-heptamethyl-1,5-diazocane |
| SMILES | CC1CC(C)(C)N(C(C)(C)C)C(C)(C)CC(C)(C)N1C(C)(C)C |
| InChI | InChI=1S/C21H44N2/c1-16-14-19(8,9)23(18(5,6)7)21(12,13)15-20(10,11)22(16)17(2,3)4/h16H,14-15H2,1-13H3 |
| InChIKey | IQGLECRBVADAMM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |