C30H52N2O6 — CID 146575555
2-[2-[2-[4-amino-N-[2-(2-methoxyethoxy)ethyl]-3-methylanilino]ethoxy]ethoxy]ethyl (E)-3-methylundec-5-enoate (PubChem CID 146575555) has the molecular formula C30H52N2O6 and a molecular weight of 536.75 g/mol. Its IUPAC name is 2-[2-[2-[4-amino-N-[2-(2-methoxyethoxy)ethyl]-3-methylanilino]ethoxy]ethoxy]ethyl (E)-3-methylundec-5-enoate.
| Compound Name | 2-[2-[2-[4-amino-N-[2-(2-methoxyethoxy)ethyl]-3-methylanilino]ethoxy]ethoxy]ethyl (E)-3-methylundec-5-enoate |
|---|---|
| PubChem CID | 146575555 |
| Molecular Formula | C30H52N2O6 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.38 |
| IUPAC Name | 2-[2-[2-[4-amino-N-[2-(2-methoxyethoxy)ethyl]-3-methylanilino]ethoxy]ethoxy]ethyl (E)-3-methylundec-5-enoate |
| SMILES | CCCCC/C=C/CC(C)CC(=O)OCCOCCOCCN(CCOCCOC)c1ccc(N)c(C)c1 |
| InChI | InChI=1S/C30H52N2O6/c1-5-6-7-8-9-10-11-26(2)24-30(33)38-23-22-37-21-20-36-17-15-32(14-16-35-19-18-34-4)28-12-13-29(31)27(3)25-28/h9-10,12-13,25-26H,5-8,11,14-24,31H2,1-4H3/b10-9+ |
| InChIKey | ZNQZOTCBNYLRQZ-MDZDMXLPSA-N |
| XLogP | 5.18 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|