C20H16ClN3O2 — CID 146583072
2-[4-(3-chlorophenyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide (PubChem CID 146583072) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(3-chlorophenyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146583072 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[4-(3-chlorophenyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)NC(c1ccc(-c3cccc(Cl)c3)cc1)N2 |
| InChI | InChI=1S/C20H16ClN3O2/c21-16-3-1-2-14(10-16)12-4-6-13(7-5-12)19-22-17-9-8-15(20(25)24-26)11-18(17)23-19/h1-11,19,22-23,26H,(H,24,25) |
| InChIKey | HXSUAIMCUPEWQE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|