C16H11F6N3O2 — CID 146583076
2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide (PubChem CID 146583076) has the molecular formula C16H11F6N3O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146583076 |
| Molecular Formula | C16H11F6N3O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-2,3-dihydro-1H-benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)NC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N2 |
| InChI | InChI=1S/C16H11F6N3O2/c17-15(18,19)9-3-8(4-10(6-9)16(20,21)22)13-23-11-2-1-7(14(26)25-27)5-12(11)24-13/h1-6,13,23-24,27H,(H,25,26) |
| InChIKey | BYSVFPOKQVYSEO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|