C9H10IN — CID 146590185
3-iodo-6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 146590185) has the molecular formula C9H10IN and a molecular weight of 259.09 g/mol. Its IUPAC name is 3-iodo-6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
| Compound Name | 3-iodo-6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
|---|---|
| PubChem CID | 146590185 |
| Molecular Formula | C9H10IN |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 3-iodo-6-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| SMILES | CC1Cc2cnc(I)cc2C1 |
| InChI | InChI=1S/C9H10IN/c1-6-2-7-4-9(10)11-5-8(7)3-6/h4-6H,2-3H2,1H3 |
| InChIKey | TTXDGZKEDVBFAP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|